Dehydrolithocholic acid
| Catalog Number | BL-M000473 |
| CAS Number | 1553-56-6 |
| Description | Dehydrolithocholic acid, a crucial bile acid derivative, is employed for managing liver ailments such as cholestasis and gallstones. Its capacity to enhance bile secretion and facilitate cholesterol metabolism positions it as a pivotal therapeutic intervention for conditions pertaining to the hepatobiliary system. |
 | |
| IUPAC Name | (4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Synonyms | 5beta-cholanic acid-3-one; 3-Ketolithocholic acid; 3-Oxocholanic acid; 3-Oxolithocholic acid |
| Molecular Weight | 374.56 |
| Molecular Formula | C24H38 O3 |
| Boiling Point | 509.3±23.0 °C(Predicted) |
| Melting Point | 509.3°C |
| Purity | >99% |
| Density | 1.069 g/cm3 |
| Appearance | Powder |
| Shelf Life | 1 Year |
| Storage | Store at -20°C |
| Percent Composition | C 76.96%, H 10.23%, O 12.81% |
| Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(CCC3C2CCC4C3(CCC(=O)C4)C)C |
| InChI | InChI=1S/C24H38O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h15-16,18-21H,4-14H2,1-3H3,(H,26,27)/t15-,16-,18+,19-,20+,21+,23+,24-/m1/s1 |
| InChI Key | KIQFUORWRVZTHT-OPTMKGCMSA-N |
※ Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Related Products
Online Inquiry
