Cholesterol 5,6-epoxide
| Catalog Number | BL-M001295 |
| CAS Number | 1250-95-9 |
| Description | Cholesterol 5,6-epoxide, a crucial cholesterol metabolite linked to atherosclerosis and cancer progression, holds significance in drug metabolism and toxicology investigations. Its intricate involvement in cellular pathways warrants further exploration for potential therapeutic interventions and disease prevention strategies. |
 | |
| IUPAC Name | (1S,2R,5S,7R,9S,11S,12S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol |
| Synonyms | cholestanol, 5alpha,6alpha-epoxy; 5alpha,6alpha-epoxy-cholesterol; 5alpha,6alpha-epoxy-5alpha-cholestan-3beta-olcholesterol-5alpha,6alpha-epoxide |
| Molecular Weight | 402.65 |
| Molecular Formula | C27H46O2 |
| Boiling Point | 497.7°C at 760mmHg |
| Purity | >99% |
| Density | 1.04 g/cm3 |
| Appearance | Powder |
| Shelf Life | 1 Year |
| Storage | Store at -20°C |
| Percent Composition | C 80.54%, H 11.51%, O 7.95% |
| Canonical SMILES | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC4C5(C3(CCC(C5)O)C)O4)C |
| InChI | InChI=1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-20-15-24-27(29-24)16-19(28)11-14-26(27,5)23(20)12-13-25(21,22)4/h17-24,28H,6-16H2,1-5H3/t18-,19+,20+,21-,22+,23+,24+,25-,26-,27+/m1/s1 |
| InChI Key | PRYIJAGAEJZDBO-ZEQHCUNVSA-N |
※ Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Related Products
Online Inquiry
