3beta,7alpha-dihydroxy-5-cholestenoic acid
| Catalog Number | BL-M001311 |
| CAS Number | 115538-84-6 |
| Description | 3beta,7alpha-dihydroxy-5-cholestenoic acid is a compound crucial to investigate bile acid metabolism and transportation within the biomedical field. Additionally, it serves as a pivotal stepping stone in the production of bile acids, integral for the breakdown and assimilation of fats in the human physiological system. |
 | |
| IUPAC Name | (6R)-6-[(3S,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
| Synonyms | (25R)-cholest-5-en-26-oic acid, 3beta,7alpha-hydroxy; 3,7-Dihydroxy-5-cholestenoic acid; 3beta,7alpha-Dihydroxy-5-cholesten-26-oic acid |
| Molecular Weight | 432.64 |
| Molecular Formula | C27H44O4 |
| Boiling Point | 588.1°C at 760 mmHg |
| Purity | >99% |
| Density | 1.12 g/cm3 |
| Appearance | Powder |
| Shelf Life | 1 Year |
| Storage | Store at -20°C |
| Percent Composition | C 74.96%, H 10.25%, O 14.79% |
| Canonical SMILES | CC(CCCC(C)C(=O)O)C1CCC2C1(CCC3C2C(C=C4C3(CCC(C4)O)C)O)C |
| InChI | InChI=1S/C27H44O4/c1-16(6-5-7-17(2)25(30)31)20-8-9-21-24-22(11-13-27(20,21)4)26(3)12-10-19(28)14-18(26)15-23(24)29/h15-17,19-24,28-29H,5-14H2,1-4H3,(H,30,31)/t16-,17?,19+,20-,21+,22+,23-,24+,26+,27-/m1/s1 |
| InChI Key | GYJSAWZGYQXRBS-GRJZKGIBSA-N |
※ Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Related Products
Online Inquiry
