18:1 dimethylacetal
| Catalog Number | BL-M000790 |
| CAS Number | 15677-71-1 |
| Description | 18:1 dimethylacetal is a crucial reagent in chemical synthesis, playing a pivotal role in the creation of diverse pharmaceutical compounds and drug intermediates. Furthermore, it acts as a fundamental component for the development of antiviral and antibacterial agents, showcasing its indispensable nature in the field of medicinal chemistry. |
 | |
| IUPAC Name | 1,1-dimethoxyoctadec-9-ene |
| Synonyms | 9Z-octadecenal-dimethylacetal; 1,1-dimethoxy-(9Z)octadecene; 9-Octadecene, 1,1-dimethoxy-, (9Z)-; 1,1-dimethoxyoctadec-9-ene |
| Molecular Weight | 312.53 |
| Molecular Formula | C20H40O2 |
| Boiling Point | 386.2±35.0 °C at 760 mmHg |
| Purity | >99% |
| Density | 0.9±0.1 g/cm3 |
| Appearance | Chloroform |
| Shelf Life | 1 Year |
| Storage | Store at -20°C |
| Percent Composition | C 76.86%, H 12.90%, O 10.24% |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(OC)OC |
| InChI | InChI=1S/C20H40O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21-2)22-3/h11-12,20H,4-10,13-19H2,1-3H3 |
| InChI Key | WBNMCUYSZJIEFY-UHFFFAOYSA-N |
※ Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Related Products
Online Inquiry
