18:1 CDP DG (ammonium salt)
| Catalog Number | BL-M000548 |
| CAS Number | 799812-77-4 |
| Description | 18:1 CDP DG (ammonium salt) serves as a crucial phospholipid in the intricate process of synthesizing phosphatidic acid, a pivotal cell signaling molecule. Additionally, it plays a pivotal role in modulating enzymes directly associated with lipid metabolism. The therapeutic prospects of this compound are promising, particularly in addressing lipid dysregulation-related disorders. |
 | |
| IUPAC Name | diazanium;[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] phosphate |
| Synonyms | 1,2-dioleoyl-sn-glycero-3-(cytidine diphosphate) (ammonium salt); CDP-DAG (ammonium salt) |
| Molecular Weight | 1040.21 |
| Molecular Formula | C48H91N5O15P2 |
| Purity | >99% |
| Appearance | Powder; Chloroform |
| Shelf Life | 1 Year |
| Storage | Store at -20°C |
| Percent Composition | C 55.42%, H 8.82%, N 6.73%, O 23.07%, P 5.96% |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OP(=O)([O-])OCC1C(C(C(O1)N2C=CC(=NC2=O)N)O)O)OC(=O)CCCCCCCC=CCCCCCCCC.[NH4+].[NH4+] |
| InChI | InChI=1S/C48H85N3O15P2.2H3N/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-43(52)61-37-40(64-44(53)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)38-62-67(57,58)66-68(59,60)63-39-41-45(54)46(55)47(65-41)51-36-35-42(49)50-48(51)56;;/h17-20,35-36,40-41,45-47,54-55H,3-16,21-34,37-39H2,1-2H3,(H,57,58)(H,59,60)(H2,49,50,56);2*1H3/b19-17-,20-18-;;/t40-,41-,45+,46?,47-;;/m1../s1 |
| InChI Key | NECNTGAHQCHVGS-BQGZBBTBSA-N |
※ Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Related Products
Online Inquiry
