06:0 PS (sodium salt)
| Catalog Number | BL-M000809 |
| CAS Number | 321862-85-5 |
| Description | 06:0 PS (sodium salt) is a phosphatidylserine derivative that plays a crucial role in cell signaling and neurotransmitter function within the biomedical field. Its multifaceted properties have led to its exploration in potential therapeutic avenues for conditions such as Alzheimer's disease, ADHD, and age-related cognitive decline. |
 | |
| IUPAC Name | sodium;(2S)-2-azaniumyl-3-[[(2R)-2,3-di(hexanoyloxy)propoxy]-oxidophosphoryl]oxypropanoate |
| Synonyms | 1,2-dihexanoyl-sn-glycero-3-phospho-L-serine (sodium salt); PS(6:0/6:0) (sodium salt) |
| Molecular Weight | 477.42 |
| Molecular Formula | C18H33NO10PNa |
| Purity | >99% |
| Appearance | Powder; Chloroform |
| Shelf Life | 1 Year |
| Storage | Store at -20°C |
| Percent Composition | C 45.28%, H 6.97%, N 2.93%, Na 4.82%, O 33.51%, P 6.49% |
| Canonical SMILES | CCCCCC(=O)OCC(COP(=O)([O-])OCC(C(=O)[O-])[NH3+])OC(=O)CCCCC.[Na+] |
| InChI | InChI=1S/C18H34NO10P.Na/c1-3-5-7-9-16(20)26-11-14(29-17(21)10-8-6-4-2)12-27-30(24,25)28-13-15(19)18(22)23;/h14-15H,3-13,19H2,1-2H3,(H,22,23)(H,24,25);/q;+1/p-1/t14-,15+;/m1./s1 |
| InChI Key | OPDYVXCKOQKYDZ-LIOBNPLQSA-M |
※ Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Related Products
Online Inquiry
